C20H19F4NO — CID 55808363
1-[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]-2-[4-(trifluoromethyl)phenyl]ethanone (PubChem CID 55808363) has the molecular formula C20H19F4NO and a molecular weight of 365.37 g/mol. Its IUPAC name is 1-[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]-2-[4-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]-2-[4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 55808363 |
| Molecular Formula | C20H19F4NO |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]-2-[4-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(Cc1ccc(C(F)(F)F)cc1)N1CCCC1Cc1cccc(F)c1 |
| InChI | InChI=1S/C20H19F4NO/c21-17-4-1-3-15(11-17)12-18-5-2-10-25(18)19(26)13-14-6-8-16(9-7-14)20(22,23)24/h1,3-4,6-9,11,18H,2,5,10,12-13H2 |
| InChIKey | MKRIMKKVYGDGEJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |