C20H21ClFNO2 — CID 55805134
3-(4-chlorophenoxy)-1-[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]propan-1-one (PubChem CID 55805134) has the molecular formula C20H21ClFNO2 and a molecular weight of 361.84 g/mol. Its IUPAC name is 3-(4-chlorophenoxy)-1-[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-(4-chlorophenoxy)-1-[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 55805134 |
| Molecular Formula | C20H21ClFNO2 |
| Molecular Weight | 361.84 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 3-(4-chlorophenoxy)-1-[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]propan-1-one |
| SMILES | O=C(CCOc1ccc(Cl)cc1)N1CCCC1Cc1cccc(F)c1 |
| InChI | InChI=1S/C20H21ClFNO2/c21-16-6-8-19(9-7-16)25-12-10-20(24)23-11-2-5-18(23)14-15-3-1-4-17(22)13-15/h1,3-4,6-9,13,18H,2,5,10-12,14H2 |
| InChIKey | WONYHDUKXXXKPK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.84 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |