C15H19Cl2N3O — CID 119375001
(4-aminopiperidin-1-yl)-quinolin-8-ylmethanone;dihydrochloride (PubChem CID 119375001) has the molecular formula C15H19Cl2N3O and a molecular weight of 328.24 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-quinolin-8-ylmethanone;dihydrochloride.
| Compound Name | (4-aminopiperidin-1-yl)-quinolin-8-ylmethanone;dihydrochloride |
|---|---|
| PubChem CID | 119375001 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (4-aminopiperidin-1-yl)-quinolin-8-ylmethanone;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(C(=O)c2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C15H17N3O.2ClH/c16-12-6-9-18(10-7-12)15(19)13-5-1-3-11-4-2-8-17-14(11)13;;/h1-5,8,12H,6-7,9-10,16H2;2*1H |
| InChIKey | WHJAHLWHDBOPFG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |