C16H21Cl2N3O — CID 119464977
[3-(aminomethyl)piperidin-1-yl]-quinolin-8-ylmethanone;dihydrochloride (PubChem CID 119464977) has the molecular formula C16H21Cl2N3O and a molecular weight of 342.27 g/mol. Its IUPAC name is [3-(aminomethyl)piperidin-1-yl]-quinolin-8-ylmethanone;dihydrochloride.
| Compound Name | [3-(aminomethyl)piperidin-1-yl]-quinolin-8-ylmethanone;dihydrochloride |
|---|---|
| PubChem CID | 119464977 |
| Molecular Formula | C16H21Cl2N3O |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | [3-(aminomethyl)piperidin-1-yl]-quinolin-8-ylmethanone;dihydrochloride |
| SMILES | Cl.Cl.NCC1CCCN(C(=O)c2cccc3cccnc23)C1 |
| InChI | InChI=1S/C16H19N3O.2ClH/c17-10-12-4-3-9-19(11-12)16(20)14-7-1-5-13-6-2-8-18-15(13)14;;/h1-2,5-8,12H,3-4,9-11,17H2;2*1H |
| InChIKey | IIOCKXOIHOZYJK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |