C14H23Cl2N3O — CID 120727378
[3-(2-aminoethyl)piperidin-1-yl]-(2-methyl-3-pyridinyl)methanone;dihydrochloride (PubChem CID 120727378) has the molecular formula C14H23Cl2N3O and a molecular weight of 320.26 g/mol. Its IUPAC name is [3-(2-aminoethyl)piperidin-1-yl]-(2-methyl-3-pyridinyl)methanone;dihydrochloride.
| Compound Name | [3-(2-aminoethyl)piperidin-1-yl]-(2-methyl-3-pyridinyl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 120727378 |
| Molecular Formula | C14H23Cl2N3O |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | [3-(2-aminoethyl)piperidin-1-yl]-(2-methyl-3-pyridinyl)methanone;dihydrochloride |
| SMILES | Cc1ncccc1C(=O)N1CCCC(CCN)C1.Cl.Cl |
| InChI | InChI=1S/C14H21N3O.2ClH/c1-11-13(5-2-8-16-11)14(18)17-9-3-4-12(10-17)6-7-15;;/h2,5,8,12H,3-4,6-7,9-10,15H2,1H3;2*1H |
| InChIKey | KLCAUZKYJXLLSS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |