C15H18BrClN4O — CID 119376856
(4-aminopiperidin-1-yl)-(4-bromo-3-phenyl-1H-pyrazol-5-yl)methanone;hydrochloride (PubChem CID 119376856) has the molecular formula C15H18BrClN4O and a molecular weight of 385.69 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-(4-bromo-3-phenyl-1H-pyrazol-5-yl)methanone;hydrochloride.
| Compound Name | (4-aminopiperidin-1-yl)-(4-bromo-3-phenyl-1H-pyrazol-5-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119376856 |
| Molecular Formula | C15H18BrClN4O |
| Molecular Weight | 385.69 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | (4-aminopiperidin-1-yl)-(4-bromo-3-phenyl-1H-pyrazol-5-yl)methanone;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)c2[nH]nc(-c3ccccc3)c2Br)CC1 |
| InChI | InChI=1S/C15H17BrN4O.ClH/c16-12-13(10-4-2-1-3-5-10)18-19-14(12)15(21)20-8-6-11(17)7-9-20;/h1-5,11H,6-9,17H2,(H,18,19);1H |
| InChIKey | KYLUNYSXXZWLNO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.69 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |