C17H22BrClN4O — CID 119612480
N-[2-(aminomethyl)cyclohexyl]-4-bromo-3-phenyl-1H-pyrazole-5-carboxamide;hydrochloride (PubChem CID 119612480) has the molecular formula C17H22BrClN4O and a molecular weight of 413.75 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-4-bromo-3-phenyl-1H-pyrazole-5-carboxamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-4-bromo-3-phenyl-1H-pyrazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119612480 |
| Molecular Formula | C17H22BrClN4O |
| Molecular Weight | 413.75 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-4-bromo-3-phenyl-1H-pyrazole-5-carboxamide;hydrochloride |
| SMILES | Cl.NCC1CCCCC1NC(=O)c1[nH]nc(-c2ccccc2)c1Br |
| InChI | InChI=1S/C17H21BrN4O.ClH/c18-14-15(11-6-2-1-3-7-11)21-22-16(14)17(23)20-13-9-5-4-8-12(13)10-19;/h1-3,6-7,12-13H,4-5,8-10,19H2,(H,20,23)(H,21,22);1H |
| InChIKey | PNCYNIDMZQFYNJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.75 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |