C13H18BrN3O3 — CID 119377242
N-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-5-bromo-N-methylfuran-2-carboxamide (PubChem CID 119377242) has the molecular formula C13H18BrN3O3 and a molecular weight of 344.21 g/mol. Its IUPAC name is N-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-5-bromo-N-methylfuran-2-carboxamide.
| Compound Name | N-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-5-bromo-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 119377242 |
| Molecular Formula | C13H18BrN3O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | N-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-5-bromo-N-methylfuran-2-carboxamide |
| SMILES | CN(CC(=O)N1CCCC(N)C1)C(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H18BrN3O3/c1-16(13(19)10-4-5-11(14)20-10)8-12(18)17-6-2-3-9(15)7-17/h4-5,9H,2-3,6-8,15H2,1H3 |
| InChIKey | XSXFBMRBAQBTPR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |