C15H22BrN3O3 — CID 86823045
5-bromo-N-[2-[4-(dimethylamino)piperidin-1-yl]-2-oxoethyl]-N-methylfuran-2-carboxamide (PubChem CID 86823045) has the molecular formula C15H22BrN3O3 and a molecular weight of 372.26 g/mol. Its IUPAC name is 5-bromo-N-[2-[4-(dimethylamino)piperidin-1-yl]-2-oxoethyl]-N-methylfuran-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[4-(dimethylamino)piperidin-1-yl]-2-oxoethyl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 86823045 |
| Molecular Formula | C15H22BrN3O3 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 5-bromo-N-[2-[4-(dimethylamino)piperidin-1-yl]-2-oxoethyl]-N-methylfuran-2-carboxamide |
| SMILES | CN(CC(=O)N1CCC(N(C)C)CC1)C(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H22BrN3O3/c1-17(2)11-6-8-19(9-7-11)14(20)10-18(3)15(21)12-4-5-13(16)22-12/h4-5,11H,6-10H2,1-3H3 |
| InChIKey | IBMGIQQLAWEABF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |