C15H24Cl2N4O — CID 119378111
(3-aminopiperidin-1-yl)-(6-pyrrolidin-1-yl-3-pyridinyl)methanone;dihydrochloride (PubChem CID 119378111) has the molecular formula C15H24Cl2N4O and a molecular weight of 347.29 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-(6-pyrrolidin-1-yl-3-pyridinyl)methanone;dihydrochloride.
| Compound Name | (3-aminopiperidin-1-yl)-(6-pyrrolidin-1-yl-3-pyridinyl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119378111 |
| Molecular Formula | C15H24Cl2N4O |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (3-aminopiperidin-1-yl)-(6-pyrrolidin-1-yl-3-pyridinyl)methanone;dihydrochloride |
| SMILES | Cl.Cl.NC1CCCN(C(=O)c2ccc(N3CCCC3)nc2)C1 |
| InChI | InChI=1S/C15H22N4O.2ClH/c16-13-4-3-9-19(11-13)15(20)12-5-6-14(17-10-12)18-7-1-2-8-18;;/h5-6,10,13H,1-4,7-9,11,16H2;2*1H |
| InChIKey | RIHPIGZGEGBZCZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |