C14H23Cl2N5O — CID 119381184
(3-aminopiperidin-1-yl)-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone;dihydrochloride (PubChem CID 119381184) has the molecular formula C14H23Cl2N5O and a molecular weight of 348.28 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone;dihydrochloride.
| Compound Name | (3-aminopiperidin-1-yl)-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119381184 |
| Molecular Formula | C14H23Cl2N5O |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (3-aminopiperidin-1-yl)-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.NC1CCCN(C(=O)c2ccc(N3CCCC3)nn2)C1 |
| InChI | InChI=1S/C14H21N5O.2ClH/c15-11-4-3-9-19(10-11)14(20)12-5-6-13(17-16-12)18-7-1-2-8-18;;/h5-6,11H,1-4,7-10,15H2;2*1H |
| InChIKey | GKHWCQCBIANGOB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |