C16H21ClN4O2 — CID 119378470
(3-aminopiperidin-1-yl)-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methanone;hydrochloride (PubChem CID 119378470) has the molecular formula C16H21ClN4O2 and a molecular weight of 336.82 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methanone;hydrochloride.
| Compound Name | (3-aminopiperidin-1-yl)-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119378470 |
| Molecular Formula | C16H21ClN4O2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (3-aminopiperidin-1-yl)-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methanone;hydrochloride |
| SMILES | COc1ccc(-c2[nH]ncc2C(=O)N2CCCC(N)C2)cc1.Cl |
| InChI | InChI=1S/C16H20N4O2.ClH/c1-22-13-6-4-11(5-7-13)15-14(9-18-19-15)16(21)20-8-2-3-12(17)10-20;/h4-7,9,12H,2-3,8,10,17H2,1H3,(H,18,19);1H |
| InChIKey | CKZHMWQLVHBQJL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |