C15H18ClFN4O — CID 119376653
(4-aminopiperidin-1-yl)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methanone;hydrochloride (PubChem CID 119376653) has the molecular formula C15H18ClFN4O and a molecular weight of 324.79 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methanone;hydrochloride.
| Compound Name | (4-aminopiperidin-1-yl)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119376653 |
| Molecular Formula | C15H18ClFN4O |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methanone;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)c2cn[nH]c2-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C15H17FN4O.ClH/c16-11-3-1-10(2-4-11)14-13(9-18-19-14)15(21)20-7-5-12(17)6-8-20;/h1-4,9,12H,5-8,17H2,(H,18,19);1H |
| InChIKey | JVSXEKXTCRRTPC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |