C16H18ClFN4O — CID 120658691
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methanone;hydrochloride (PubChem CID 120658691) has the molecular formula C16H18ClFN4O and a molecular weight of 336.80 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methanone;hydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120658691 |
| Molecular Formula | C16H18ClFN4O |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1cn[nH]c1-c1ccc(F)cc1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C16H17FN4O.ClH/c17-13-3-1-10(2-4-13)15-14(7-19-20-15)16(22)21-8-11-5-18-6-12(11)9-21;/h1-4,7,11-12,18H,5-6,8-9H2,(H,19,20);1H/t11-,12+; |
| InChIKey | YNAMYMKUEPYRCG-IWKKHLOMSA-N |
| XLogP | 1.93 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |