C16H17FN4O — CID 120658572
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]methanone (PubChem CID 120658572) has the molecular formula C16H17FN4O and a molecular weight of 300.34 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]methanone.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 120658572 |
| Molecular Formula | C16H17FN4O |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]methanone |
| SMILES | O=C(c1cn[nH]c1-c1ccccc1F)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C16H17FN4O/c17-14-4-2-1-3-12(14)15-13(7-19-20-15)16(22)21-8-10-5-18-6-11(10)9-21/h1-4,7,10-11,18H,5-6,8-9H2,(H,19,20)/t10-,11+ |
| InChIKey | IWOHRJYQGDGXMC-PHIMTYICSA-N |
| XLogP | 1.51 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |