C16H18Cl2FN3OS — CID 120656890
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]methanone;dihydrochloride (PubChem CID 120656890) has the molecular formula C16H18Cl2FN3OS and a molecular weight of 390.31 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]methanone;dihydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 120656890 |
| Molecular Formula | C16H18Cl2FN3OS |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(c1csc(-c2ccccc2F)n1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C16H16FN3OS.2ClH/c17-13-4-2-1-3-12(13)15-19-14(9-22-15)16(21)20-7-10-5-18-6-11(10)8-20;;/h1-4,9-11,18H,5-8H2;2*1H/t10-,11+;; |
| InChIKey | KQPOSCOCMJFWSI-HVNHDPPXSA-N |
| XLogP | 3.08 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |