C14H21ClN2O3S — CID 119378692
(3-aminopiperidin-1-yl)-(4-methyl-3-methylsulfonylphenyl)methanone;hydrochloride (PubChem CID 119378692) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-(4-methyl-3-methylsulfonylphenyl)methanone;hydrochloride.
| Compound Name | (3-aminopiperidin-1-yl)-(4-methyl-3-methylsulfonylphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119378692 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (3-aminopiperidin-1-yl)-(4-methyl-3-methylsulfonylphenyl)methanone;hydrochloride |
| SMILES | Cc1ccc(C(=O)N2CCCC(N)C2)cc1S(C)(=O)=O.Cl |
| InChI | InChI=1S/C14H20N2O3S.ClH/c1-10-5-6-11(8-13(10)20(2,18)19)14(17)16-7-3-4-12(15)9-16;/h5-6,8,12H,3-4,7,9,15H2,1-2H3;1H |
| InChIKey | SYLZLMCRLOSCHM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |