C15H15F4N5O — CID 119379500
(3-aminopiperidin-1-yl)-[1-(3-fluorophenyl)-5-(trifluoromethyl)triazol-4-yl]methanone (PubChem CID 119379500) has the molecular formula C15H15F4N5O and a molecular weight of 357.31 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-[1-(3-fluorophenyl)-5-(trifluoromethyl)triazol-4-yl]methanone.
| Compound Name | (3-aminopiperidin-1-yl)-[1-(3-fluorophenyl)-5-(trifluoromethyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 119379500 |
| Molecular Formula | C15H15F4N5O |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (3-aminopiperidin-1-yl)-[1-(3-fluorophenyl)-5-(trifluoromethyl)triazol-4-yl]methanone |
| SMILES | NC1CCCN(C(=O)c2nnn(-c3cccc(F)c3)c2C(F)(F)F)C1 |
| InChI | InChI=1S/C15H15F4N5O/c16-9-3-1-5-11(7-9)24-13(15(17,18)19)12(21-22-24)14(25)23-6-2-4-10(20)8-23/h1,3,5,7,10H,2,4,6,8,20H2 |
| InChIKey | NEJAHKZNJVLPBR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |