C14H18Cl2N4O4 — CID 119380089
N-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-2-chloro-6-nitrobenzamide;hydrochloride (PubChem CID 119380089) has the molecular formula C14H18Cl2N4O4 and a molecular weight of 377.23 g/mol. Its IUPAC name is N-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-2-chloro-6-nitrobenzamide;hydrochloride.
| Compound Name | N-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-2-chloro-6-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119380089 |
| Molecular Formula | C14H18Cl2N4O4 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | N-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-2-chloro-6-nitrobenzamide;hydrochloride |
| SMILES | Cl.NC1CCCN(C(=O)CNC(=O)c2c(Cl)cccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C14H17ClN4O4.ClH/c15-10-4-1-5-11(19(22)23)13(10)14(21)17-7-12(20)18-6-2-3-9(16)8-18;/h1,4-5,9H,2-3,6-8,16H2,(H,17,21);1H |
| InChIKey | LEVKSKNDINQRRY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|