C13H20Cl2N4O — CID 119386084
5-chloro-N-piperidin-4-yl-2-propan-2-ylpyrimidine-4-carboxamide;hydrochloride (PubChem CID 119386084) has the molecular formula C13H20Cl2N4O and a molecular weight of 319.24 g/mol. Its IUPAC name is 5-chloro-N-piperidin-4-yl-2-propan-2-ylpyrimidine-4-carboxamide;hydrochloride.
| Compound Name | 5-chloro-N-piperidin-4-yl-2-propan-2-ylpyrimidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119386084 |
| Molecular Formula | C13H20Cl2N4O |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 5-chloro-N-piperidin-4-yl-2-propan-2-ylpyrimidine-4-carboxamide;hydrochloride |
| SMILES | CC(C)c1ncc(Cl)c(C(=O)NC2CCNCC2)n1.Cl |
| InChI | InChI=1S/C13H19ClN4O.ClH/c1-8(2)12-16-7-10(14)11(18-12)13(19)17-9-3-5-15-6-4-9;/h7-9,15H,3-6H2,1-2H3,(H,17,19);1H |
| InChIKey | KXDRKUAKPHYGEN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |