C17H28Cl2N4O — CID 119619321
5-chloro-N-[2-(cycloheptylamino)ethyl]-2-propan-2-ylpyrimidine-4-carboxamide;hydrochloride (PubChem CID 119619321) has the molecular formula C17H28Cl2N4O and a molecular weight of 375.34 g/mol. Its IUPAC name is 5-chloro-N-[2-(cycloheptylamino)ethyl]-2-propan-2-ylpyrimidine-4-carboxamide;hydrochloride.
| Compound Name | 5-chloro-N-[2-(cycloheptylamino)ethyl]-2-propan-2-ylpyrimidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119619321 |
| Molecular Formula | C17H28Cl2N4O |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 5-chloro-N-[2-(cycloheptylamino)ethyl]-2-propan-2-ylpyrimidine-4-carboxamide;hydrochloride |
| SMILES | CC(C)c1ncc(Cl)c(C(=O)NCCNC2CCCCCC2)n1.Cl |
| InChI | InChI=1S/C17H27ClN4O.ClH/c1-12(2)16-21-11-14(18)15(22-16)17(23)20-10-9-19-13-7-5-3-4-6-8-13;/h11-13,19H,3-10H2,1-2H3,(H,20,23);1H |
| InChIKey | HNSIZHVYMBSLJQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|