C24H33N3O2 — CID 119387048
N-[[4-(piperidin-4-ylcarbamoyl)phenyl]methyl]adamantane-1-carboxamide (PubChem CID 119387048) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[[4-(piperidin-4-ylcarbamoyl)phenyl]methyl]adamantane-1-carboxamide.
| Compound Name | N-[[4-(piperidin-4-ylcarbamoyl)phenyl]methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 119387048 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | N-[[4-(piperidin-4-ylcarbamoyl)phenyl]methyl]adamantane-1-carboxamide |
| SMILES | O=C(NC1CCNCC1)c1ccc(CNC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C24H33N3O2/c28-22(27-21-5-7-25-8-6-21)20-3-1-16(2-4-20)15-26-23(29)24-12-17-9-18(13-24)11-19(10-17)14-24/h1-4,17-19,21,25H,5-15H2,(H,26,29)(H,27,28) |
| InChIKey | NIIQWPKVPYFFHF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |