C22H32ClN3O2 — CID 119501131
N-[[4-[2-(methylamino)ethylcarbamoyl]phenyl]methyl]adamantane-1-carboxamide;hydrochloride (PubChem CID 119501131) has the molecular formula C22H32ClN3O2 and a molecular weight of 405.97 g/mol. Its IUPAC name is N-[[4-[2-(methylamino)ethylcarbamoyl]phenyl]methyl]adamantane-1-carboxamide;hydrochloride.
| Compound Name | N-[[4-[2-(methylamino)ethylcarbamoyl]phenyl]methyl]adamantane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119501131 |
| Molecular Formula | C22H32ClN3O2 |
| Molecular Weight | 405.97 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-[[4-[2-(methylamino)ethylcarbamoyl]phenyl]methyl]adamantane-1-carboxamide;hydrochloride |
| SMILES | CNCCNC(=O)c1ccc(CNC(=O)C23CC4CC(CC(C4)C2)C3)cc1.Cl |
| InChI | InChI=1S/C22H31N3O2.ClH/c1-23-6-7-24-20(26)19-4-2-15(3-5-19)14-25-21(27)22-11-16-8-17(12-22)10-18(9-16)13-22;/h2-5,16-18,23H,6-14H2,1H3,(H,24,26)(H,25,27);1H |
| InChIKey | DAPDGIZXNIYCKG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.97 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|