C28H34N2O4 — CID 46586709
N-[[4-[(2,4-dimethoxyphenyl)methylcarbamoyl]phenyl]methyl]adamantane-1-carboxamide (PubChem CID 46586709) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is N-[[4-[(2,4-dimethoxyphenyl)methylcarbamoyl]phenyl]methyl]adamantane-1-carboxamide.
| Compound Name | N-[[4-[(2,4-dimethoxyphenyl)methylcarbamoyl]phenyl]methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 46586709 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | N-[[4-[(2,4-dimethoxyphenyl)methylcarbamoyl]phenyl]methyl]adamantane-1-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(CNC(=O)C34CC5CC(CC(C5)C3)C4)cc2)c(OC)c1 |
| InChI | InChI=1S/C28H34N2O4/c1-33-24-8-7-23(25(12-24)34-2)17-29-26(31)22-5-3-18(4-6-22)16-30-27(32)28-13-19-9-20(14-28)11-21(10-19)15-28/h3-8,12,19-21H,9-11,13-17H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | RYTQMORCDBRNOM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |