C16H20Cl2N4O — CID 119390437
3-(2-chlorophenyl)-1-methyl-N-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride (PubChem CID 119390437) has the molecular formula C16H20Cl2N4O and a molecular weight of 355.27 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-methyl-N-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride.
| Compound Name | 3-(2-chlorophenyl)-1-methyl-N-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119390437 |
| Molecular Formula | C16H20Cl2N4O |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 3-(2-chlorophenyl)-1-methyl-N-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride |
| SMILES | Cl.Cn1cc(C(=O)NC2CCNCC2)c(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C16H19ClN4O.ClH/c1-21-10-13(16(22)19-11-6-8-18-9-7-11)15(20-21)12-4-2-3-5-14(12)17;/h2-5,10-11,18H,6-9H2,1H3,(H,19,22);1H |
| InChIKey | AFQACSXIYNMKLE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |