C19H28Cl2N4O3 — CID 119391867
1-(5-chloro-2-methoxyphenyl)-5-oxo-N-(3-piperazin-1-ylpropyl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119391867) has the molecular formula C19H28Cl2N4O3 and a molecular weight of 431.36 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-5-oxo-N-(3-piperazin-1-ylpropyl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-5-oxo-N-(3-piperazin-1-ylpropyl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119391867 |
| Molecular Formula | C19H28Cl2N4O3 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-5-oxo-N-(3-piperazin-1-ylpropyl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | COc1ccc(Cl)cc1N1CC(C(=O)NCCCN2CCNCC2)CC1=O.Cl |
| InChI | InChI=1S/C19H27ClN4O3.ClH/c1-27-17-4-3-15(20)12-16(17)24-13-14(11-18(24)25)19(26)22-5-2-8-23-9-6-21-7-10-23;/h3-4,12,14,21H,2,5-11,13H2,1H3,(H,22,26);1H |
| InChIKey | GOQUBFZOVACMIY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|