C21H21Cl2N3O4 — CID 29127931
(3R)-N-[2-[(2,4-dichlorobenzoyl)amino]ethyl]-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 29127931) has the molecular formula C21H21Cl2N3O4 and a molecular weight of 450.32 g/mol. Its IUPAC name is (3R)-N-[2-[(2,4-dichlorobenzoyl)amino]ethyl]-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[2-[(2,4-dichlorobenzoyl)amino]ethyl]-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 29127931 |
| Molecular Formula | C21H21Cl2N3O4 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | (3R)-N-[2-[(2,4-dichlorobenzoyl)amino]ethyl]-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccccc1N1C[C@H](C(=O)NCCNC(=O)c2ccc(Cl)cc2Cl)CC1=O |
| InChI | InChI=1S/C21H21Cl2N3O4/c1-30-18-5-3-2-4-17(18)26-12-13(10-19(26)27)20(28)24-8-9-25-21(29)15-7-6-14(22)11-16(15)23/h2-7,11,13H,8-10,12H2,1H3,(H,24,28)(H,25,29)/t13-/m1/s1 |
| InChIKey | SBZIMDZWCRPYQX-CYBMUJFWSA-N |
| XLogP | 2.90 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|