C17H26Cl2N4O3 — CID 119393013
2-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride (PubChem CID 119393013) has the molecular formula C17H26Cl2N4O3 and a molecular weight of 405.33 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride.
| Compound Name | 2-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119393013 |
| Molecular Formula | C17H26Cl2N4O3 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride |
| SMILES | Cc1oc(-c2ccco2)nc1CC(=O)NCCCN1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H24N4O3.2ClH/c1-13-14(20-17(24-13)15-4-2-11-23-15)12-16(22)19-5-3-8-21-9-6-18-7-10-21;;/h2,4,11,18H,3,5-10,12H2,1H3,(H,19,22);2*1H |
| InChIKey | USBJBPAWXHDYMT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|