C19H27ClN4O2S — CID 119394434
2-[(2-phenyl-1,3-oxazol-4-yl)methylsulfanyl]-N-(3-piperazin-1-ylpropyl)acetamide;hydrochloride (PubChem CID 119394434) has the molecular formula C19H27ClN4O2S and a molecular weight of 410.97 g/mol. Its IUPAC name is 2-[(2-phenyl-1,3-oxazol-4-yl)methylsulfanyl]-N-(3-piperazin-1-ylpropyl)acetamide;hydrochloride.
| Compound Name | 2-[(2-phenyl-1,3-oxazol-4-yl)methylsulfanyl]-N-(3-piperazin-1-ylpropyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119394434 |
| Molecular Formula | C19H27ClN4O2S |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[(2-phenyl-1,3-oxazol-4-yl)methylsulfanyl]-N-(3-piperazin-1-ylpropyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CSCc1coc(-c2ccccc2)n1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C19H26N4O2S.ClH/c24-18(21-7-4-10-23-11-8-20-9-12-23)15-26-14-17-13-25-19(22-17)16-5-2-1-3-6-16;/h1-3,5-6,13,20H,4,7-12,14-15H2,(H,21,24);1H |
| InChIKey | PFSLQTXKEUFDKF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|