C17H26ClN3O4S — CID 119394987
2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-1-[3-(methylaminomethyl)piperidin-1-yl]ethanone;hydrochloride (PubChem CID 119394987) has the molecular formula C17H26ClN3O4S and a molecular weight of 403.93 g/mol. Its IUPAC name is 2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-1-[3-(methylaminomethyl)piperidin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-1-[3-(methylaminomethyl)piperidin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 119394987 |
| Molecular Formula | C17H26ClN3O4S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-1-[3-(methylaminomethyl)piperidin-1-yl]ethanone;hydrochloride |
| SMILES | CNCC1CCCN(C(=O)CSCc2ccc(OC)c([N+](=O)[O-])c2)C1.Cl |
| InChI | InChI=1S/C17H25N3O4S.ClH/c1-18-9-14-4-3-7-19(10-14)17(21)12-25-11-13-5-6-16(24-2)15(8-13)20(22)23;/h5-6,8,14,18H,3-4,7,9-12H2,1-2H3;1H |
| InChIKey | DYWDWOBISABAOB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|