C21H26ClN3O5 — CID 119398826
[2-(4-methoxyphenoxy)-5-nitrophenyl]-[3-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119398826) has the molecular formula C21H26ClN3O5 and a molecular weight of 435.91 g/mol. Its IUPAC name is [2-(4-methoxyphenoxy)-5-nitrophenyl]-[3-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | [2-(4-methoxyphenoxy)-5-nitrophenyl]-[3-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119398826 |
| Molecular Formula | C21H26ClN3O5 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | [2-(4-methoxyphenoxy)-5-nitrophenyl]-[3-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CNCC1CCCN(C(=O)c2cc([N+](=O)[O-])ccc2Oc2ccc(OC)cc2)C1.Cl |
| InChI | InChI=1S/C21H25N3O5.ClH/c1-22-13-15-4-3-11-23(14-15)21(25)19-12-16(24(26)27)5-10-20(19)29-18-8-6-17(28-2)7-9-18;/h5-10,12,15,22H,3-4,11,13-14H2,1-2H3;1H |
| InChIKey | ANRQHXPWGLZFNX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|