C21H25N3O5 — CID 120815106
(4-amino-3,3-dimethylpiperidin-1-yl)-[2-(4-methoxyphenoxy)-5-nitrophenyl]methanone (PubChem CID 120815106) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is (4-amino-3,3-dimethylpiperidin-1-yl)-[2-(4-methoxyphenoxy)-5-nitrophenyl]methanone.
| Compound Name | (4-amino-3,3-dimethylpiperidin-1-yl)-[2-(4-methoxyphenoxy)-5-nitrophenyl]methanone |
|---|---|
| PubChem CID | 120815106 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (4-amino-3,3-dimethylpiperidin-1-yl)-[2-(4-methoxyphenoxy)-5-nitrophenyl]methanone |
| SMILES | COc1ccc(Oc2ccc([N+](=O)[O-])cc2C(=O)N2CCC(N)C(C)(C)C2)cc1 |
| InChI | InChI=1S/C21H25N3O5/c1-21(2)13-23(11-10-19(21)22)20(25)17-12-14(24(26)27)4-9-18(17)29-16-7-5-15(28-3)6-8-16/h4-9,12,19H,10-11,13,22H2,1-3H3 |
| InChIKey | HTDCWIBDOSSDJJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|