C16H22FN3O2 — CID 119395232
N-[4-fluoro-3-[3-(methylaminomethyl)piperidine-1-carbonyl]phenyl]acetamide (PubChem CID 119395232) has the molecular formula C16H22FN3O2 and a molecular weight of 307.37 g/mol. Its IUPAC name is N-[4-fluoro-3-[3-(methylaminomethyl)piperidine-1-carbonyl]phenyl]acetamide.
| Compound Name | N-[4-fluoro-3-[3-(methylaminomethyl)piperidine-1-carbonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 119395232 |
| Molecular Formula | C16H22FN3O2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-[4-fluoro-3-[3-(methylaminomethyl)piperidine-1-carbonyl]phenyl]acetamide |
| SMILES | CNCC1CCCN(C(=O)c2cc(NC(C)=O)ccc2F)C1 |
| InChI | InChI=1S/C16H22FN3O2/c1-11(21)19-13-5-6-15(17)14(8-13)16(22)20-7-3-4-12(10-20)9-18-2/h5-6,8,12,18H,3-4,7,9-10H2,1-2H3,(H,19,21) |
| InChIKey | AQVNDFOEZDMJRY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |