C14H13ClN2O3S — CID 11939752
(1R,2R,6R,7R,11R)-3-(4-chlorophenyl)-11-hydroxy-4-sulfanylidene-8-oxa-3,5-diazatricyclo[5.2.2.02,6]undecan-9-one (PubChem CID 11939752) has the molecular formula C14H13ClN2O3S and a molecular weight of 324.79 g/mol. Its IUPAC name is (1R,2R,6R,7R,11R)-3-(4-chlorophenyl)-11-hydroxy-4-sulfanylidene-8-oxa-3,5-diazatricyclo[5.2.2.02,6]undecan-9-one.
| Compound Name | (1R,2R,6R,7R,11R)-3-(4-chlorophenyl)-11-hydroxy-4-sulfanylidene-8-oxa-3,5-diazatricyclo[5.2.2.02,6]undecan-9-one |
|---|---|
| PubChem CID | 11939752 |
| Molecular Formula | C14H13ClN2O3S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | (1R,2R,6R,7R,11R)-3-(4-chlorophenyl)-11-hydroxy-4-sulfanylidene-8-oxa-3,5-diazatricyclo[5.2.2.02,6]undecan-9-one |
| SMILES | O=C1O[C@@H]2[C@@H]3NC(=S)N(c4ccc(Cl)cc4)[C@@H]3[C@H]1C[C@H]2O |
| InChI | InChI=1S/C14H13ClN2O3S/c15-6-1-3-7(4-2-6)17-11-8-5-9(18)12(20-13(8)19)10(11)16-14(17)21/h1-4,8-12,18H,5H2,(H,16,21)/t8-,9-,10-,11-,12+/m1/s1 |
| InChIKey | XRQDUSOHBZKPMJ-OOCWMUITSA-N |
| XLogP | 1.08 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|