C18H22ClN7O — CID 119399997
5-methyl-1-piperidin-4-yl-N-(2-pyrazol-1-ylphenyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119399997) has the molecular formula C18H22ClN7O and a molecular weight of 387.88 g/mol. Its IUPAC name is 5-methyl-1-piperidin-4-yl-N-(2-pyrazol-1-ylphenyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | 5-methyl-1-piperidin-4-yl-N-(2-pyrazol-1-ylphenyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119399997 |
| Molecular Formula | C18H22ClN7O |
| Molecular Weight | 387.88 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 5-methyl-1-piperidin-4-yl-N-(2-pyrazol-1-ylphenyl)triazole-4-carboxamide;hydrochloride |
| SMILES | Cc1c(C(=O)Nc2ccccc2-n2cccn2)nnn1C1CCNCC1.Cl |
| InChI | InChI=1S/C18H21N7O.ClH/c1-13-17(22-23-25(13)14-7-10-19-11-8-14)18(26)21-15-5-2-3-6-16(15)24-12-4-9-20-24;/h2-6,9,12,14,19H,7-8,10-11H2,1H3,(H,21,26);1H |
| InChIKey | XJRPTXPGYHVCIA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.88 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |