C16H24BrClN2O3 — CID 119400587
2-(2-bromo-4,5-diethoxyphenyl)-1-piperazin-1-ylethanone;hydrochloride (PubChem CID 119400587) has the molecular formula C16H24BrClN2O3 and a molecular weight of 407.74 g/mol. Its IUPAC name is 2-(2-bromo-4,5-diethoxyphenyl)-1-piperazin-1-ylethanone;hydrochloride.
| Compound Name | 2-(2-bromo-4,5-diethoxyphenyl)-1-piperazin-1-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 119400587 |
| Molecular Formula | C16H24BrClN2O3 |
| Molecular Weight | 407.74 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 2-(2-bromo-4,5-diethoxyphenyl)-1-piperazin-1-ylethanone;hydrochloride |
| SMILES | CCOc1cc(Br)c(CC(=O)N2CCNCC2)cc1OCC.Cl |
| InChI | InChI=1S/C16H23BrN2O3.ClH/c1-3-21-14-9-12(13(17)11-15(14)22-4-2)10-16(20)19-7-5-18-6-8-19;/h9,11,18H,3-8,10H2,1-2H3;1H |
| InChIKey | ZGAZTLKSIVTXPH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.74 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |