C15H22Cl2N4OS — CID 119400771
2-[2-(methylsulfanylmethyl)benzimidazol-1-yl]-1-piperazin-1-ylethanone;dihydrochloride (PubChem CID 119400771) has the molecular formula C15H22Cl2N4OS and a molecular weight of 377.34 g/mol. Its IUPAC name is 2-[2-(methylsulfanylmethyl)benzimidazol-1-yl]-1-piperazin-1-ylethanone;dihydrochloride.
| Compound Name | 2-[2-(methylsulfanylmethyl)benzimidazol-1-yl]-1-piperazin-1-ylethanone;dihydrochloride |
|---|---|
| PubChem CID | 119400771 |
| Molecular Formula | C15H22Cl2N4OS |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-[2-(methylsulfanylmethyl)benzimidazol-1-yl]-1-piperazin-1-ylethanone;dihydrochloride |
| SMILES | CSCc1nc2ccccc2n1CC(=O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H20N4OS.2ClH/c1-21-11-14-17-12-4-2-3-5-13(12)19(14)10-15(20)18-8-6-16-7-9-18;;/h2-5,16H,6-11H2,1H3;2*1H |
| InChIKey | VYQSGMPUGNVEQN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |