C17H21N3O3S — CID 99633817
(3R)-1-[2-[2-(methylsulfanylmethyl)benzimidazol-1-yl]acetyl]piperidine-3-carboxylic acid (PubChem CID 99633817) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is (3R)-1-[2-[2-(methylsulfanylmethyl)benzimidazol-1-yl]acetyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-[2-(methylsulfanylmethyl)benzimidazol-1-yl]acetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 99633817 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (3R)-1-[2-[2-(methylsulfanylmethyl)benzimidazol-1-yl]acetyl]piperidine-3-carboxylic acid |
| SMILES | CSCc1nc2ccccc2n1CC(=O)N1CCC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C17H21N3O3S/c1-24-11-15-18-13-6-2-3-7-14(13)20(15)10-16(21)19-8-4-5-12(9-19)17(22)23/h2-3,6-7,12H,4-5,8-11H2,1H3,(H,22,23)/t12-/m1/s1 |
| InChIKey | RFZFANMSKYTBEV-GFCCVEGCSA-N |
| XLogP | 2.22 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |