C22H25N3O5S — CID 11940083
(3aS,4R,5R,7R,7aR)-2-(3,5-dimethoxyanilino)-4,5-dihydroxy-N-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 11940083) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is (3aS,4R,5R,7R,7aR)-2-(3,5-dimethoxyanilino)-4,5-dihydroxy-N-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | (3aS,4R,5R,7R,7aR)-2-(3,5-dimethoxyanilino)-4,5-dihydroxy-N-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 11940083 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | (3aS,4R,5R,7R,7aR)-2-(3,5-dimethoxyanilino)-4,5-dihydroxy-N-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | COc1cc(NC2=N[C@H]3[C@@H](O)[C@H](O)C[C@H](C(=O)Nc4ccccc4)[C@H]3S2)cc(OC)c1 |
| InChI | InChI=1S/C22H25N3O5S/c1-29-14-8-13(9-15(10-14)30-2)24-22-25-18-19(27)17(26)11-16(20(18)31-22)21(28)23-12-6-4-3-5-7-12/h3-10,16-20,26-27H,11H2,1-2H3,(H,23,28)(H,24,25)/t16-,17+,18-,19-,20+/m0/s1 |
| InChIKey | MJLNRAVRFYYLLZ-LJDSDSDDSA-N |
| XLogP | 2.34 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |