C21H27F3N4O5S — CID 28991447
(3aS,4R,5R,7R,7aR)-4,5-dihydroxy-N-(2-morpholin-4-ylethyl)-2-[4-(trifluoromethoxy)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 28991447) has the molecular formula C21H27F3N4O5S and a molecular weight of 504.53 g/mol. Its IUPAC name is (3aS,4R,5R,7R,7aR)-4,5-dihydroxy-N-(2-morpholin-4-ylethyl)-2-[4-(trifluoromethoxy)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | (3aS,4R,5R,7R,7aR)-4,5-dihydroxy-N-(2-morpholin-4-ylethyl)-2-[4-(trifluoromethoxy)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 28991447 |
| Molecular Formula | C21H27F3N4O5S |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | (3aS,4R,5R,7R,7aR)-4,5-dihydroxy-N-(2-morpholin-4-ylethyl)-2-[4-(trifluoromethoxy)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)[C@H]1C[C@@H](O)[C@H](O)[C@@H]2N=C(Nc3ccc(OC(F)(F)F)cc3)S[C@@H]21 |
| InChI | InChI=1S/C21H27F3N4O5S/c22-21(23,24)33-13-3-1-12(2-4-13)26-20-27-16-17(30)15(29)11-14(18(16)34-20)19(31)25-5-6-28-7-9-32-10-8-28/h1-4,14-18,29-30H,5-11H2,(H,25,31)(H,26,27)/t14-,15+,16-,17-,18+/m0/s1 |
| InChIKey | DEBBIEJZYMYRKD-FLXSYLCISA-N |
| XLogP | 1.03 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |