C19H22F3N3O5S — CID 11940091
[(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-2-sulfanylidene-3-[4-(trifluoromethoxy)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-4-yl]-morpholin-4-ylmethanone (PubChem CID 11940091) has the molecular formula C19H22F3N3O5S and a molecular weight of 461.46 g/mol. Its IUPAC name is [(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-2-sulfanylidene-3-[4-(trifluoromethoxy)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-2-sulfanylidene-3-[4-(trifluoromethoxy)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 11940091 |
| Molecular Formula | C19H22F3N3O5S |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | [(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-2-sulfanylidene-3-[4-(trifluoromethoxy)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C([C@@H]1C[C@@H](O)[C@H](O)[C@@H]2NC(=S)N(c3ccc(OC(F)(F)F)cc3)[C@@H]21)N1CCOCC1 |
| InChI | InChI=1S/C19H22F3N3O5S/c20-19(21,22)30-11-3-1-10(2-4-11)25-15-12(17(28)24-5-7-29-8-6-24)9-13(26)16(27)14(15)23-18(25)31/h1-4,12-16,26-27H,5-9H2,(H,23,31)/t12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | MENJUJUQYLEWMB-QCODTGAPSA-N |
| XLogP | 0.62 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|