C22H24FN3O4S — CID 11939737
(3aR,4R,6R,7R,7aR)-1-[(4-fluorophenyl)methyl]-6,7-dihydroxy-3-(4-methoxyphenyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzimidazole-4-carboxamide (PubChem CID 11939737) has the molecular formula C22H24FN3O4S and a molecular weight of 445.52 g/mol. Its IUPAC name is (3aR,4R,6R,7R,7aR)-1-[(4-fluorophenyl)methyl]-6,7-dihydroxy-3-(4-methoxyphenyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzimidazole-4-carboxamide.
| Compound Name | (3aR,4R,6R,7R,7aR)-1-[(4-fluorophenyl)methyl]-6,7-dihydroxy-3-(4-methoxyphenyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 11939737 |
| Molecular Formula | C22H24FN3O4S |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | (3aR,4R,6R,7R,7aR)-1-[(4-fluorophenyl)methyl]-6,7-dihydroxy-3-(4-methoxyphenyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzimidazole-4-carboxamide |
| SMILES | COc1ccc(N2C(=S)N(Cc3ccc(F)cc3)[C@H]3[C@@H](O)[C@H](O)C[C@@H](C(N)=O)[C@H]32)cc1 |
| InChI | InChI=1S/C22H24FN3O4S/c1-30-15-8-6-14(7-9-15)26-18-16(21(24)29)10-17(27)20(28)19(18)25(22(26)31)11-12-2-4-13(23)5-3-12/h2-9,16-20,27-28H,10-11H2,1H3,(H2,24,29)/t16-,17-,18-,19-,20+/m1/s1 |
| InChIKey | ULCQDLSOXRCJSC-WAPOTWQKSA-N |
| XLogP | 1.41 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|