C19H23F3N4O5S — CID 40780747
(3aR,4R,6R,7R,7aR)-N-(2-acetamidoethyl)-6,7-dihydroxy-2-sulfanylidene-3-[4-(trifluoromethoxy)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 40780747) has the molecular formula C19H23F3N4O5S and a molecular weight of 476.48 g/mol. Its IUPAC name is (3aR,4R,6R,7R,7aR)-N-(2-acetamidoethyl)-6,7-dihydroxy-2-sulfanylidene-3-[4-(trifluoromethoxy)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | (3aR,4R,6R,7R,7aR)-N-(2-acetamidoethyl)-6,7-dihydroxy-2-sulfanylidene-3-[4-(trifluoromethoxy)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 40780747 |
| Molecular Formula | C19H23F3N4O5S |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | (3aR,4R,6R,7R,7aR)-N-(2-acetamidoethyl)-6,7-dihydroxy-2-sulfanylidene-3-[4-(trifluoromethoxy)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | CC(=O)NCCNC(=O)[C@@H]1C[C@@H](O)[C@H](O)[C@@H]2NC(=S)N(c3ccc(OC(F)(F)F)cc3)[C@@H]21 |
| InChI | InChI=1S/C19H23F3N4O5S/c1-9(27)23-6-7-24-17(30)12-8-13(28)16(29)14-15(12)26(18(32)25-14)10-2-4-11(5-3-10)31-19(20,21)22/h2-5,12-16,28-29H,6-8H2,1H3,(H,23,27)(H,24,30)(H,25,32)/t12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | PFWUWKZVNVRVMW-QCODTGAPSA-N |
| XLogP | 0.01 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|