C20H27F3N4O7 — CID 7134478
(1S,3R,4R,5S)-N-[(2R)-1-amino-3-methyl-1-oxobutan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide (PubChem CID 7134478) has the molecular formula C20H27F3N4O7 and a molecular weight of 492.45 g/mol. Its IUPAC name is (1S,3R,4R,5S)-N-[(2R)-1-amino-3-methyl-1-oxobutan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R,5S)-N-[(2R)-1-amino-3-methyl-1-oxobutan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 7134478 |
| Molecular Formula | C20H27F3N4O7 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (1S,3R,4R,5S)-N-[(2R)-1-amino-3-methyl-1-oxobutan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
| SMILES | CC(C)[C@@H](NC(=O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)Nc2ccc(OC(F)(F)F)cc2)C1)C(N)=O |
| InChI | InChI=1S/C20H27F3N4O7/c1-9(2)14(16(24)30)27-17(31)19(33)7-12(15(29)13(28)8-19)26-18(32)25-10-3-5-11(6-4-10)34-20(21,22)23/h3-6,9,12-15,28-29,33H,7-8H2,1-2H3,(H2,24,30)(H,27,31)(H2,25,26,32)/t12-,13+,14+,15+,19-/m0/s1 |
| InChIKey | VKUIKUMQKMSKRE-IPCTWKPDSA-N |
| XLogP | -0.05 |
| TPSA | 183.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |