C19H25F3N4O7 — CID 3854656
N-(4-amino-4-oxobutyl)-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide (PubChem CID 3854656) has the molecular formula C19H25F3N4O7 and a molecular weight of 478.42 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide.
| Compound Name | N-(4-amino-4-oxobutyl)-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 3854656 |
| Molecular Formula | C19H25F3N4O7 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
| SMILES | NC(=O)CCCNC(=O)C1(O)CC(O)C(O)C(NC(=O)Nc2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C19H25F3N4O7/c20-19(21,22)33-11-5-3-10(4-6-11)25-17(31)26-12-8-18(32,9-13(27)15(12)29)16(30)24-7-1-2-14(23)28/h3-6,12-13,15,27,29,32H,1-2,7-9H2,(H2,23,28)(H,24,30)(H2,25,26,31) |
| InChIKey | BXJLSNJJOJSSQQ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 183.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|