C15H16N4O2S2 — CID 119404828
N-(3-aminopropyl)-2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 119404828) has the molecular formula C15H16N4O2S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-(3-aminopropyl)-2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 119404828 |
| Molecular Formula | C15H16N4O2S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | N-(3-aminopropyl)-2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | NCCCNC(=O)Cn1cnc2scc(-c3cccs3)c2c1=O |
| InChI | InChI=1S/C15H16N4O2S2/c16-4-2-5-17-12(20)7-19-9-18-14-13(15(19)21)10(8-23-14)11-3-1-6-22-11/h1,3,6,8-9H,2,4-5,7,16H2,(H,17,20) |
| InChIKey | KYNJSSQCQZRTQD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|