C18H12Cl2N4O2S2 — CID 55450729
N-(4-amino-3,5-dichlorophenyl)-2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 55450729) has the molecular formula C18H12Cl2N4O2S2 and a molecular weight of 451.36 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 55450729 |
| Molecular Formula | C18H12Cl2N4O2S2 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 449.98 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | Nc1c(Cl)cc(NC(=O)Cn2cnc3scc(-c4cccs4)c3c2=O)cc1Cl |
| InChI | InChI=1S/C18H12Cl2N4O2S2/c19-11-4-9(5-12(20)16(11)21)23-14(25)6-24-8-22-17-15(18(24)26)10(7-28-17)13-2-1-3-27-13/h1-5,7-8H,6,21H2,(H,23,25) |
| InChIKey | SUJVLHPDYXEKSW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|