C23H19N3O4S2 — CID 24529986
ethyl (E)-3-[4-[[2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetyl]amino]phenyl]prop-2-enoate (PubChem CID 24529986) has the molecular formula C23H19N3O4S2 and a molecular weight of 465.56 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 24529986 |
| Molecular Formula | C23H19N3O4S2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | ethyl (E)-3-[4-[[2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)Cn2cnc3scc(-c4cccs4)c3c2=O)cc1 |
| InChI | InChI=1S/C23H19N3O4S2/c1-2-30-20(28)10-7-15-5-8-16(9-6-15)25-19(27)12-26-14-24-22-21(23(26)29)17(13-32-22)18-4-3-11-31-18/h3-11,13-14H,2,12H2,1H3,(H,25,27)/b10-7+ |
| InChIKey | XNLHFSHWJVOJMW-JXMROGBWSA-N |
| XLogP | 4.40 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|