C12H18Cl2N4OS — CID 119405470
N-(3-aminopropyl)-4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxamide;dihydrochloride (PubChem CID 119405470) has the molecular formula C12H18Cl2N4OS and a molecular weight of 337.28 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxamide;dihydrochloride.
| Compound Name | N-(3-aminopropyl)-4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119405470 |
| Molecular Formula | C12H18Cl2N4OS |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-(3-aminopropyl)-4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxamide;dihydrochloride |
| SMILES | Cc1nc(-c2c[nH]c(C(=O)NCCCN)c2)cs1.Cl.Cl |
| InChI | InChI=1S/C12H16N4OS.2ClH/c1-8-16-11(7-18-8)9-5-10(15-6-9)12(17)14-4-2-3-13;;/h5-7,15H,2-4,13H2,1H3,(H,14,17);2*1H |
| InChIKey | GSHFUOBOAPLPIO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|