C16H14N4O2S — CID 35513092
N'-benzoyl-4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carbohydrazide (PubChem CID 35513092) has the molecular formula C16H14N4O2S and a molecular weight of 326.38 g/mol. Its IUPAC name is N'-benzoyl-4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-benzoyl-4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 35513092 |
| Molecular Formula | C16H14N4O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N'-benzoyl-4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carbohydrazide |
| SMILES | Cc1nc(-c2c[nH]c(C(=O)NNC(=O)c3ccccc3)c2)cs1 |
| InChI | InChI=1S/C16H14N4O2S/c1-10-18-14(9-23-10)12-7-13(17-8-12)16(22)20-19-15(21)11-5-3-2-4-6-11/h2-9,17H,1H3,(H,19,21)(H,20,22) |
| InChIKey | MONFEYXSMFNHNJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|